C12H18O2S — CID 10376423
S-[(2,2,3,4-tetramethyl-5-oxocyclopent-3-en-1-yl)methyl] ethanethioate (PubChem CID 10376423) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is S-[(2,2,3,4-tetramethyl-5-oxocyclopent-3-en-1-yl)methyl] ethanethioate.
| Compound Name | S-[(2,2,3,4-tetramethyl-5-oxocyclopent-3-en-1-yl)methyl] ethanethioate |
|---|---|
| PubChem CID | 10376423 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | S-[(2,2,3,4-tetramethyl-5-oxocyclopent-3-en-1-yl)methyl] ethanethioate |
| SMILES | CC(=O)SCC1C(=O)C(C)=C(C)C1(C)C |
| InChI | InChI=1S/C12H18O2S/c1-7-8(2)12(4,5)10(11(7)14)6-15-9(3)13/h10H,6H2,1-5H3 |
| InChIKey | SCLWRRZMKAAIEA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|