C11H15N3OS — CID 103766109
N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 103766109) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 103766109 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | Cc1cc(CNCCc2ncno2)c(C)s1 |
| InChI | InChI=1S/C11H15N3OS/c1-8-5-10(9(2)16-8)6-12-4-3-11-13-7-14-15-11/h5,7,12H,3-4,6H2,1-2H3 |
| InChIKey | SCNHUCZIUJDRPO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|