C10H16F3NO — CID 103766554
N-[(1-ethylcyclopentyl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 103766554) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is N-[(1-ethylcyclopentyl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1-ethylcyclopentyl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 103766554 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-[(1-ethylcyclopentyl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | CCC1(CNC(=O)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C10H16F3NO/c1-2-9(5-3-4-6-9)7-14-8(15)10(11,12)13/h2-7H2,1H3,(H,14,15) |
| InChIKey | VDIKFEAOJRSHDQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |