C16H18FNO2 — CID 103767118
2-fluoro-4-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide (PubChem CID 103767118) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide.
| Compound Name | 2-fluoro-4-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide |
|---|---|
| PubChem CID | 103767118 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-fluoro-4-methoxy-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide |
| SMILES | COc1ccc(C(=O)NC2C3C4CCC(C4)C23)c(F)c1 |
| InChI | InChI=1S/C16H18FNO2/c1-20-10-4-5-11(12(17)7-10)16(19)18-15-13-8-2-3-9(6-8)14(13)15/h4-5,7-9,13-15H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | ZVIYWTQGYYWEKH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |