C13H18ClNO3S — CID 103767358
5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methoxybenzamide (PubChem CID 103767358) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is 5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 103767358 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NCCSCCCO |
| InChI | InChI=1S/C13H18ClNO3S/c1-18-12-4-3-10(14)9-11(12)13(17)15-5-8-19-7-2-6-16/h3-4,9,16H,2,5-8H2,1H3,(H,15,17) |
| InChIKey | DNCPODFTRBOFLM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|