C15H22O2 — CID 10376746
(1R,4R,6R,7S,11S)-6-methoxy-4-propan-2-yl-5-oxatetracyclo[5.3.2.01,6.04,11]dodec-9-ene (PubChem CID 10376746) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,4R,6R,7S,11S)-6-methoxy-4-propan-2-yl-5-oxatetracyclo[5.3.2.01,6.04,11]dodec-9-ene.
| Compound Name | (1R,4R,6R,7S,11S)-6-methoxy-4-propan-2-yl-5-oxatetracyclo[5.3.2.01,6.04,11]dodec-9-ene |
|---|---|
| PubChem CID | 10376746 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,4R,6R,7S,11S)-6-methoxy-4-propan-2-yl-5-oxatetracyclo[5.3.2.01,6.04,11]dodec-9-ene |
| SMILES | CO[C@]12O[C@@]3(C(C)C)CC[C@]14C=CC[C@H]2C[C@@H]43 |
| InChI | InChI=1S/C15H22O2/c1-10(2)14-8-7-13-6-4-5-11(9-12(13)14)15(13,16-3)17-14/h4,6,10-12H,5,7-9H2,1-3H3/t11-,12-,13-,14+,15+/m0/s1 |
| InChIKey | SZESDGKITNCANQ-BTFPBAQTSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|