About 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate
2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate (PubChem CID 10376762) has the molecular formula C6H9N3O5S
and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate |
| PubChem CID | 10376762 |
| Molecular Formula | C6H9N3O5S |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate |
| SMILES | O=C1N[C@@H](C(=O)NCCO[N+](=O)[O-])CS1 |
| InChI | InChI=1S/C6H9N3O5S/c10-5(4-3-15-6(11)8-4)7-1-2-14-9(12)13/h4H,1-3H2,(H,7,10)(H,8,11)/t4-/m1/s1 |
| InChIKey | WSPFZJVPRYXFFX-SCSAIBSYSA-N |
| XLogP | -0.86 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate?
The IUPAC name of 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate (CID 10376762) is 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate.
What is the SMILES notation for 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate?
The canonical SMILES for 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate is O=C1N[C@@H](C(=O)NCCO[N+](=O)[O-])CS1.
What is the InChIKey of 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate?
The InChIKey is WSPFZJVPRYXFFX-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H9N3O5S/c10-5(4-3-15-6(11)8-4)7-1-2-14-9(12)13/h4H,1-3H2,(H,7,10)(H,8,11)/t4-/m1/s1.
What are the key properties of 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate?
2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate has a molecular weight of 235.22 g/mol, XLogP of -0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4S)-2-oxo-1,3-thiazolidine-4-carbonyl]amino]ethyl nitrate is sourced from PubChem (CID 10376762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).