About 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine
5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine (PubChem CID 10376796) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine |
| PubChem CID | 10376796 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine |
| SMILES | CCCN1C[C@H](c2ccc(N)nc2)OC[C@@H]1C |
| InChI | InChI=1S/C13H21N3O/c1-3-6-16-8-12(17-9-10(16)2)11-4-5-13(14)15-7-11/h4-5,7,10,12H,3,6,8-9H2,1-2H3,(H2,14,15)/t10-,12+/m0/s1 |
| InChIKey | DFTCYTDJDXZFSK-CMPLNLGQSA-N |
| XLogP | 1.84 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine?
The IUPAC name of 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine (CID 10376796) is 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine.
What is the SMILES notation for 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine?
The canonical SMILES for 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine is CCCN1C[C@H](c2ccc(N)nc2)OC[C@@H]1C.
What is the InChIKey of 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine?
The InChIKey is DFTCYTDJDXZFSK-CMPLNLGQSA-N. The full InChI is InChI=1S/C13H21N3O/c1-3-6-16-8-12(17-9-10(16)2)11-4-5-13(14)15-7-11/h4-5,7,10,12H,3,6,8-9H2,1-2H3,(H2,14,15)/t10-,12+/m0/s1.
What are the key properties of 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine?
5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine has a molecular weight of 235.33 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,5S)-5-methyl-4-propylmorpholin-2-yl]pyridin-2-amine is sourced from PubChem (CID 10376796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).