C6H3F7N2 — CID 10376804
5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole (PubChem CID 10376804) has the molecular formula C6H3F7N2 and a molecular weight of 236.09 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole |
|---|---|
| PubChem CID | 10376804 |
| Molecular Formula | C6H3F7N2 |
| Molecular Weight | 236.09 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1ccn[nH]1 |
| InChI | InChI=1S/C6H3F7N2/c7-4(8,3-1-2-14-15-3)5(9,10)6(11,12)13/h1-2H,(H,14,15) |
| InChIKey | ZJNFZKRETOIRSX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.09 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|