C14H19ClFNO — CID 103769034
N-[(4-chloro-3-fluorophenyl)methyl]-1-(oxan-4-yl)ethanamine (PubChem CID 103769034) has the molecular formula C14H19ClFNO and a molecular weight of 271.76 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)methyl]-1-(oxan-4-yl)ethanamine.
| Compound Name | N-[(4-chloro-3-fluorophenyl)methyl]-1-(oxan-4-yl)ethanamine |
|---|---|
| PubChem CID | 103769034 |
| Molecular Formula | C14H19ClFNO |
| Molecular Weight | 271.76 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)methyl]-1-(oxan-4-yl)ethanamine |
| SMILES | CC(NCc1ccc(Cl)c(F)c1)C1CCOCC1 |
| InChI | InChI=1S/C14H19ClFNO/c1-10(12-4-6-18-7-5-12)17-9-11-2-3-13(15)14(16)8-11/h2-3,8,10,12,17H,4-7,9H2,1H3 |
| InChIKey | MPPRHJRAGMYJEK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |