About 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide
2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide (PubChem CID 103769310) has the molecular formula C10H16F3NO2S
and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide.
Molecular Properties
| Compound Name | 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
| PubChem CID | 103769310 |
| Molecular Formula | C10H16F3NO2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
| SMILES | O=C(CC1CCSCC1)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H16F3NO2S/c11-10(12,13)8(15)6-14-9(16)5-7-1-3-17-4-2-7/h7-8,15H,1-6H2,(H,14,16) |
| InChIKey | HDGQQHBQUQSJFG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
The IUPAC name of 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide (CID 103769310) is 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide.
What is the SMILES notation for 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
The canonical SMILES for 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide is O=C(CC1CCSCC1)NCC(O)C(F)(F)F.
What is the InChIKey of 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
The InChIKey is HDGQQHBQUQSJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO2S/c11-10(12,13)8(15)6-14-9(16)5-7-1-3-17-4-2-7/h7-8,15H,1-6H2,(H,14,16).
What are the key properties of 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide?
2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide has a molecular weight of 271.30 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thian-4-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide is sourced from PubChem (CID 103769310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).