About N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide
N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide (PubChem CID 103769698) has the molecular formula C9H13F2NO2
and a molecular weight of 205.20 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide.
Molecular Properties
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide |
| PubChem CID | 103769698 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)C1CC=CC1 |
| InChI | InChI=1S/C9H13F2NO2/c10-8(11)7(13)5-12-9(14)6-3-1-2-4-6/h1-2,6-8,13H,3-5H2,(H,12,14) |
| InChIKey | JRKIDIXJMPKGMS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide?
The IUPAC name of N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide (CID 103769698) is N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide.
What is the SMILES notation for N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide?
The canonical SMILES for N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide is O=C(NCC(O)C(F)F)C1CC=CC1.
What is the InChIKey of N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide?
The InChIKey is JRKIDIXJMPKGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO2/c10-8(11)7(13)5-12-9(14)6-3-1-2-4-6/h1-2,6-8,13H,3-5H2,(H,12,14).
What are the key properties of N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide?
N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide has a molecular weight of 205.20 g/mol, XLogP of 0.69, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluoro-2-hydroxypropyl)cyclopent-3-ene-1-carboxamide is sourced from PubChem (CID 103769698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).