About 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide (PubChem CID 103769728) has the molecular formula C11H12ClF2NO2S
and a molecular weight of 295.74 g/mol. Its IUPAC name is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide |
| PubChem CID | 103769728 |
| Molecular Formula | C11H12ClF2NO2S |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCC(O)C(F)F)c1 |
| InChI | InChI=1S/C11H12ClF2NO2S/c1-18-6-2-3-8(12)7(4-6)11(17)15-5-9(16)10(13)14/h2-4,9-10,16H,5H2,1H3,(H,15,17) |
| InChIKey | NDOHKFMCGMAHFW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide?
The IUPAC name of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide (CID 103769728) is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide.
What is the SMILES notation for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide?
The canonical SMILES for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide is CSc1ccc(Cl)c(C(=O)NCC(O)C(F)F)c1.
What is the InChIKey of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide?
The InChIKey is NDOHKFMCGMAHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF2NO2S/c1-18-6-2-3-8(12)7(4-6)11(17)15-5-9(16)10(13)14/h2-4,9-10,16H,5H2,1H3,(H,15,17).
What are the key properties of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide?
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide has a molecular weight of 295.74 g/mol, XLogP of 2.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-5-methylsulfanylbenzamide is sourced from PubChem (CID 103769728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).