About N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide
N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide (PubChem CID 103769815) has the molecular formula C7H8F2N2O2S
and a molecular weight of 222.22 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 103769815 |
| Molecular Formula | C7H8F2N2O2S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)c1cncs1 |
| InChI | InChI=1S/C7H8F2N2O2S/c8-6(9)4(12)1-11-7(13)5-2-10-3-14-5/h2-4,6,12H,1H2,(H,11,13) |
| InChIKey | CNUJWHXCKFDFBZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide (CID 103769815) is N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide is O=C(NCC(O)C(F)F)c1cncs1.
What is the InChIKey of N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide?
The InChIKey is CNUJWHXCKFDFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2S/c8-6(9)4(12)1-11-7(13)5-2-10-3-14-5/h2-4,6,12H,1H2,(H,11,13).
What are the key properties of N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide?
N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide has a molecular weight of 222.22 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluoro-2-hydroxypropyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 103769815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).