C13H16F2N2O3 — CID 103769854
N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide (PubChem CID 103769854) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide.
| Compound Name | N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 103769854 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccccc1)NCC(O)C(F)F |
| InChI | InChI=1S/C13H16F2N2O3/c14-12(15)10(18)8-17-11(19)6-7-16-13(20)9-4-2-1-3-5-9/h1-5,10,12,18H,6-8H2,(H,16,20)(H,17,19) |
| InChIKey | AYADLVBFQWNUGE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |