About N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide
N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide (PubChem CID 103769854) has the molecular formula C13H16F2N2O3
and a molecular weight of 286.28 g/mol. Its IUPAC name is N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide.
Molecular Properties
| Compound Name | N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide |
| PubChem CID | 103769854 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccccc1)NCC(O)C(F)F |
| InChI | InChI=1S/C13H16F2N2O3/c14-12(15)10(18)8-17-11(19)6-7-16-13(20)9-4-2-1-3-5-9/h1-5,10,12,18H,6-8H2,(H,16,20)(H,17,19) |
| InChIKey | AYADLVBFQWNUGE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide?
The IUPAC name of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide (CID 103769854) is N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide.
What is the SMILES notation for N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide?
The canonical SMILES for N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide is O=C(CCNC(=O)c1ccccc1)NCC(O)C(F)F.
What is the InChIKey of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide?
The InChIKey is AYADLVBFQWNUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N2O3/c14-12(15)10(18)8-17-11(19)6-7-16-13(20)9-4-2-1-3-5-9/h1-5,10,12,18H,6-8H2,(H,16,20)(H,17,19).
What are the key properties of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide?
N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide has a molecular weight of 286.28 g/mol, XLogP of 0.55, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]benzamide is sourced from PubChem (CID 103769854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).