C13H17F2NO2S — CID 103769898
N-(3,3-difluoro-2-hydroxypropyl)-2-(2-phenylethylsulfanyl)acetamide (PubChem CID 103769898) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2-(2-phenylethylsulfanyl)acetamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(2-phenylethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 103769898 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(2-phenylethylsulfanyl)acetamide |
| SMILES | O=C(CSCCc1ccccc1)NCC(O)C(F)F |
| InChI | InChI=1S/C13H17F2NO2S/c14-13(15)11(17)8-16-12(18)9-19-7-6-10-4-2-1-3-5-10/h1-5,11,13,17H,6-9H2,(H,16,18) |
| InChIKey | WXWOYRJZPUFCDD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|