About (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide
(E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 103769981) has the molecular formula C11H13F2NO2S
and a molecular weight of 261.29 g/mol. Its IUPAC name is (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide |
| PubChem CID | 103769981 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccsc1/C=C/C(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C11H13F2NO2S/c1-7-4-5-17-9(7)2-3-10(16)14-6-8(15)11(12)13/h2-5,8,11,15H,6H2,1H3,(H,14,16)/b3-2+ |
| InChIKey | NQMARSHYQAIDGZ-NSCUHMNNSA-N |
| XLogP | 1.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide?
The IUPAC name of (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide (CID 103769981) is (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide.
What is the SMILES notation for (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide?
The canonical SMILES for (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide is Cc1ccsc1/C=C/C(=O)NCC(O)C(F)F.
What is the InChIKey of (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide?
The InChIKey is NQMARSHYQAIDGZ-NSCUHMNNSA-N. The full InChI is InChI=1S/C11H13F2NO2S/c1-7-4-5-17-9(7)2-3-10(16)14-6-8(15)11(12)13/h2-5,8,11,15H,6H2,1H3,(H,14,16)/b3-2+.
What are the key properties of (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide?
(E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide has a molecular weight of 261.29 g/mol, XLogP of 1.81, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(3,3-difluoro-2-hydroxypropyl)-3-(3-methylthiophen-2-yl)prop-2-enamide is sourced from PubChem (CID 103769981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).