C13H17F2NO3 — CID 103770190
N-(3,3-difluoro-2-hydroxypropyl)-2-(4-ethylphenoxy)acetamide (PubChem CID 103770190) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-2-(4-ethylphenoxy)acetamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(4-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 103770190 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-2-(4-ethylphenoxy)acetamide |
| SMILES | CCc1ccc(OCC(=O)NCC(O)C(F)F)cc1 |
| InChI | InChI=1S/C13H17F2NO3/c1-2-9-3-5-10(6-4-9)19-8-12(18)16-7-11(17)13(14)15/h3-6,11,13,17H,2,7-8H2,1H3,(H,16,18) |
| InChIKey | NFLJTPVLPXWOJU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |