About N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide
N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide (PubChem CID 103770311) has the molecular formula C9H13F2NO2
and a molecular weight of 205.20 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide.
Molecular Properties
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide |
| PubChem CID | 103770311 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C9H13F2NO2/c1-2-3-4-5-8(14)12-6-7(13)9(10)11/h2-5,7,9,13H,6H2,1H3,(H,12,14) |
| InChIKey | VLZXCKZGSUJKRB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide?
The IUPAC name of N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide (CID 103770311) is N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide.
What is the SMILES notation for N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide?
The canonical SMILES for N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide is CC=CC=CC(=O)NCC(O)C(F)F.
What is the InChIKey of N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide?
The InChIKey is VLZXCKZGSUJKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2NO2/c1-2-3-4-5-8(14)12-6-7(13)9(10)11/h2-5,7,9,13H,6H2,1H3,(H,12,14).
What are the key properties of N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide?
N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide has a molecular weight of 205.20 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluoro-2-hydroxypropyl)hexa-2,4-dienamide is sourced from PubChem (CID 103770311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).