C14H20F2N2O2 — CID 103770356
N-(3,3-difluoro-2-hydroxypropyl)-3-[4-(dimethylamino)phenyl]propanamide (PubChem CID 103770356) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)-3-[4-(dimethylamino)phenyl]propanamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)-3-[4-(dimethylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 103770356 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)-3-[4-(dimethylamino)phenyl]propanamide |
| SMILES | CN(C)c1ccc(CCC(=O)NCC(O)C(F)F)cc1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-18(2)11-6-3-10(4-7-11)5-8-13(20)17-9-12(19)14(15)16/h3-4,6-7,12,14,19H,5,8-9H2,1-2H3,(H,17,20) |
| InChIKey | CAKBKTJNUMSWDN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|