About 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide
5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide (PubChem CID 103770505) has the molecular formula C8H8BrF2NO2S
and a molecular weight of 300.12 g/mol. Its IUPAC name is 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide |
| PubChem CID | 103770505 |
| Molecular Formula | C8H8BrF2NO2S |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide |
| SMILES | O=C(NCC(O)C(F)F)c1csc(Br)c1 |
| InChI | InChI=1S/C8H8BrF2NO2S/c9-6-1-4(3-15-6)8(14)12-2-5(13)7(10)11/h1,3,5,7,13H,2H2,(H,12,14) |
| InChIKey | HCXQVXTUFNDINI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide?
The IUPAC name of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide (CID 103770505) is 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide.
What is the SMILES notation for 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide?
The canonical SMILES for 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide is O=C(NCC(O)C(F)F)c1csc(Br)c1.
What is the InChIKey of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide?
The InChIKey is HCXQVXTUFNDINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF2NO2S/c9-6-1-4(3-15-6)8(14)12-2-5(13)7(10)11/h1,3,5,7,13H,2H2,(H,12,14).
What are the key properties of 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide?
5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide has a molecular weight of 300.12 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,3-difluoro-2-hydroxypropyl)thiophene-3-carboxamide is sourced from PubChem (CID 103770505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).