About N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide
N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide (PubChem CID 103770516) has the molecular formula C12H20F2N2O3
and a molecular weight of 278.30 g/mol. Its IUPAC name is N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide |
| PubChem CID | 103770516 |
| Molecular Formula | C12H20F2N2O3 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide |
| SMILES | O=C(CCNC(=O)C1CCCC1)NCC(O)C(F)F |
| InChI | InChI=1S/C12H20F2N2O3/c13-11(14)9(17)7-16-10(18)5-6-15-12(19)8-3-1-2-4-8/h8-9,11,17H,1-7H2,(H,15,19)(H,16,18) |
| InChIKey | DASUZJSAQRUMDF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide?
The IUPAC name of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide (CID 103770516) is N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide.
What is the SMILES notation for N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide?
The canonical SMILES for N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide is O=C(CCNC(=O)C1CCCC1)NCC(O)C(F)F.
What is the InChIKey of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide?
The InChIKey is DASUZJSAQRUMDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F2N2O3/c13-11(14)9(17)7-16-10(18)5-6-15-12(19)8-3-1-2-4-8/h8-9,11,17H,1-7H2,(H,15,19)(H,16,18).
What are the key properties of N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide?
N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide has a molecular weight of 278.30 g/mol, XLogP of 0.43, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(3,3-difluoro-2-hydroxypropyl)amino]-3-oxopropyl]cyclopentanecarboxamide is sourced from PubChem (CID 103770516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).