About 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide
2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide (PubChem CID 103770533) has the molecular formula C9H15F2NO2
and a molecular weight of 207.22 g/mol. Its IUPAC name is 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide.
Molecular Properties
| Compound Name | 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
| PubChem CID | 103770533 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide |
| SMILES | O=C(CC1CCC1)NCC(O)C(F)F |
| InChI | InChI=1S/C9H15F2NO2/c10-9(11)7(13)5-12-8(14)4-6-2-1-3-6/h6-7,9,13H,1-5H2,(H,12,14) |
| InChIKey | KJTSCUFSYRMQHI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
The IUPAC name of 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide (CID 103770533) is 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide.
What is the SMILES notation for 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
The canonical SMILES for 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide is O=C(CC1CCC1)NCC(O)C(F)F.
What is the InChIKey of 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
The InChIKey is KJTSCUFSYRMQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2/c10-9(11)7(13)5-12-8(14)4-6-2-1-3-6/h6-7,9,13H,1-5H2,(H,12,14).
What are the key properties of 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide?
2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide has a molecular weight of 207.22 g/mol, XLogP of 0.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-N-(3,3-difluoro-2-hydroxypropyl)acetamide is sourced from PubChem (CID 103770533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).