C14H17F4NO2 — CID 103771258
4-fluoro-N-(2-hydroxy-4-methylpentyl)-3-(trifluoromethyl)benzamide (PubChem CID 103771258) has the molecular formula C14H17F4NO2 and a molecular weight of 307.29 g/mol. Its IUPAC name is 4-fluoro-N-(2-hydroxy-4-methylpentyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-(2-hydroxy-4-methylpentyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 103771258 |
| Molecular Formula | C14H17F4NO2 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-fluoro-N-(2-hydroxy-4-methylpentyl)-3-(trifluoromethyl)benzamide |
| SMILES | CC(C)CC(O)CNC(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F4NO2/c1-8(2)5-10(20)7-19-13(21)9-3-4-12(15)11(6-9)14(16,17)18/h3-4,6,8,10,20H,5,7H2,1-2H3,(H,19,21) |
| InChIKey | OOTCVUMOIYGKQL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |