C15H22ClNO3 — CID 103771426
2-(2-chloro-5-methylphenoxy)-N-(2-hydroxy-4-methylpentyl)acetamide (PubChem CID 103771426) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-N-(2-hydroxy-4-methylpentyl)acetamide.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-N-(2-hydroxy-4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 103771426 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-N-(2-hydroxy-4-methylpentyl)acetamide |
| SMILES | Cc1ccc(Cl)c(OCC(=O)NCC(O)CC(C)C)c1 |
| InChI | InChI=1S/C15H22ClNO3/c1-10(2)6-12(18)8-17-15(19)9-20-14-7-11(3)4-5-13(14)16/h4-5,7,10,12,18H,6,8-9H2,1-3H3,(H,17,19) |
| InChIKey | ZFLWJXJBZVLWOO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |