C13H12N2O3 — CID 10377152
(7S)-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),8,10,12(16)-tetraen-2-one (PubChem CID 10377152) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is (7S)-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),8,10,12(16)-tetraen-2-one.
| Compound Name | (7S)-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),8,10,12(16)-tetraen-2-one |
|---|---|
| PubChem CID | 10377152 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (7S)-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),8,10,12(16)-tetraen-2-one |
| SMILES | O=C1c2cc3c(cc2N=C[C@@H]2CCCN12)OCO3 |
| InChI | InChI=1S/C13H12N2O3/c16-13-9-4-11-12(18-7-17-11)5-10(9)14-6-8-2-1-3-15(8)13/h4-6,8H,1-3,7H2/t8-/m0/s1 |
| InChIKey | LJQHROIYHMPJHS-QMMMGPOBSA-N |
| XLogP | 1.74 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |