About N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide
N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide (PubChem CID 103771961) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide.
Molecular Properties
| Compound Name | N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide |
| PubChem CID | 103771961 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCC1(CO)CCCCC1 |
| InChI | InChI=1S/C14H23NO2/c1-2-3-5-8-13(17)15-11-14(12-16)9-6-4-7-10-14/h2-3,5,8,16H,4,6-7,9-12H2,1H3,(H,15,17) |
| InChIKey | BLSPERYMRAARAO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide?
The IUPAC name of N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide (CID 103771961) is N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide.
What is the SMILES notation for N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide?
The canonical SMILES for N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide is CC=CC=CC(=O)NCC1(CO)CCCCC1.
What is the InChIKey of N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide?
The InChIKey is BLSPERYMRAARAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO2/c1-2-3-5-8-13(17)15-11-14(12-16)9-6-4-7-10-14/h2-3,5,8,16H,4,6-7,9-12H2,1H3,(H,15,17).
What are the key properties of N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide?
N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide has a molecular weight of 237.34 g/mol, XLogP of 2.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(hydroxymethyl)cyclohexyl]methyl]hexa-2,4-dienamide is sourced from PubChem (CID 103771961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).