C13H15N3O2 — CID 10377212
(E)-N-methyl-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enamide (PubChem CID 10377212) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is (E)-N-methyl-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enamide.
| Compound Name | (E)-N-methyl-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10377212 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (E)-N-methyl-3-(8-oxo-5,6,7,9-tetrahydropyrido[2,3-b]azepin-3-yl)prop-2-enamide |
| SMILES | CNC(=O)/C=C/c1cnc2c(c1)CCCC(=O)N2 |
| InChI | InChI=1S/C13H15N3O2/c1-14-11(17)6-5-9-7-10-3-2-4-12(18)16-13(10)15-8-9/h5-8H,2-4H2,1H3,(H,14,17)(H,15,16,18)/b6-5+ |
| InChIKey | OJEGYRCERKKFHE-AATRIKPKSA-N |
| XLogP | 1.12 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|