C14H15N3O3 — CID 103772693
N-[(1R)-2-hydroxy-1-phenylethyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 103772693) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[(1R)-2-hydroxy-1-phenylethyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[(1R)-2-hydroxy-1-phenylethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103772693 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[(1R)-2-hydroxy-1-phenylethyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)N[C@@H](CO)c2ccccc2)ccc1=O |
| InChI | InChI=1S/C14H15N3O3/c1-17-13(19)8-7-11(16-17)14(20)15-12(9-18)10-5-3-2-4-6-10/h2-8,12,18H,9H2,1H3,(H,15,20)/t12-/m0/s1 |
| InChIKey | UKLLFYUUHNANOZ-LBPRGKRZSA-N |
| XLogP | 0.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |