About [(4R)-undec-2-yn-4-yl] methanesulfonate
[(4R)-undec-2-yn-4-yl] methanesulfonate (PubChem CID 10377275) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is [(4R)-undec-2-yn-4-yl] methanesulfonate.
Molecular Properties
| Compound Name | [(4R)-undec-2-yn-4-yl] methanesulfonate |
| PubChem CID | 10377275 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | [(4R)-undec-2-yn-4-yl] methanesulfonate |
| SMILES | CC#C[C@@H](CCCCCCC)OS(C)(=O)=O |
| InChI | InChI=1S/C12H22O3S/c1-4-6-7-8-9-11-12(10-5-2)15-16(3,13)14/h12H,4,6-9,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | HUHVQSUQEWUKDA-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-undec-2-yn-4-yl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-undec-2-yn-4-yl] methanesulfonate?
The IUPAC name of [(4R)-undec-2-yn-4-yl] methanesulfonate (CID 10377275) is [(4R)-undec-2-yn-4-yl] methanesulfonate.
What is the SMILES notation for [(4R)-undec-2-yn-4-yl] methanesulfonate?
The canonical SMILES for [(4R)-undec-2-yn-4-yl] methanesulfonate is CC#C[C@@H](CCCCCCC)OS(C)(=O)=O.
What is the InChIKey of [(4R)-undec-2-yn-4-yl] methanesulfonate?
The InChIKey is HUHVQSUQEWUKDA-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H22O3S/c1-4-6-7-8-9-11-12(10-5-2)15-16(3,13)14/h12H,4,6-9,11H2,1-3H3/t12-/m0/s1.
What are the key properties of [(4R)-undec-2-yn-4-yl] methanesulfonate?
[(4R)-undec-2-yn-4-yl] methanesulfonate has a molecular weight of 246.37 g/mol, XLogP of 2.71, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-undec-2-yn-4-yl] methanesulfonate is sourced from PubChem (CID 10377275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).