C12H10O4S — CID 10377412
2,2-dioxo-1,3,4,9-tetrahydrobenzo[f][2]benzothiole-5,8-dione (PubChem CID 10377412) has the molecular formula C12H10O4S and a molecular weight of 250.27 g/mol. Its IUPAC name is 2,2-dioxo-1,3,4,9-tetrahydrobenzo[f][2]benzothiole-5,8-dione.
| Compound Name | 2,2-dioxo-1,3,4,9-tetrahydrobenzo[f][2]benzothiole-5,8-dione |
|---|---|
| PubChem CID | 10377412 |
| Molecular Formula | C12H10O4S |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 2,2-dioxo-1,3,4,9-tetrahydrobenzo[f][2]benzothiole-5,8-dione |
| SMILES | O=C1C=CC(=O)C2=C1CC1=C(C2)CS(=O)(=O)C1 |
| InChI | InChI=1S/C12H10O4S/c13-11-1-2-12(14)10-4-8-6-17(15,16)5-7(8)3-9(10)11/h1-2H,3-6H2 |
| InChIKey | FWQTXYQPHROITA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|