C8H13Cl2NO — CID 103774523
1-(2,3-dichloroprop-2-enyl)-3-methylpyrrolidin-3-ol (PubChem CID 103774523) has the molecular formula C8H13Cl2NO and a molecular weight of 210.10 g/mol. Its IUPAC name is 1-(2,3-dichloroprop-2-enyl)-3-methylpyrrolidin-3-ol.
| Compound Name | 1-(2,3-dichloroprop-2-enyl)-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103774523 |
| Molecular Formula | C8H13Cl2NO |
| Molecular Weight | 210.10 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 1-(2,3-dichloroprop-2-enyl)-3-methylpyrrolidin-3-ol |
| SMILES | CC1(O)CCN(CC(Cl)=CCl)C1 |
| InChI | InChI=1S/C8H13Cl2NO/c1-8(12)2-3-11(6-8)5-7(10)4-9/h4,12H,2-3,5-6H2,1H3 |
| InChIKey | AOTIKPFPUSHNEK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |