C10H9N3O3S — CID 10377464
methyl 5-oxo-2-sulfanylidene-1,4-dihydro-1,3,4-benzotriazepine-3-carboxylate (PubChem CID 10377464) has the molecular formula C10H9N3O3S and a molecular weight of 251.27 g/mol. Its IUPAC name is methyl 5-oxo-2-sulfanylidene-1,4-dihydro-1,3,4-benzotriazepine-3-carboxylate.
| Compound Name | methyl 5-oxo-2-sulfanylidene-1,4-dihydro-1,3,4-benzotriazepine-3-carboxylate |
|---|---|
| PubChem CID | 10377464 |
| Molecular Formula | C10H9N3O3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | methyl 5-oxo-2-sulfanylidene-1,4-dihydro-1,3,4-benzotriazepine-3-carboxylate |
| SMILES | COC(=O)N1NC(=O)c2ccccc2NC1=S |
| InChI | InChI=1S/C10H9N3O3S/c1-16-10(15)13-9(17)11-7-5-3-2-4-6(7)8(14)12-13/h2-5H,1H3,(H,11,17)(H,12,14) |
| InChIKey | XZAQFTZTGUAECA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|