About N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide
N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide (PubChem CID 103774902) has the molecular formula C7H12N2O3S2
and a molecular weight of 236.32 g/mol. Its IUPAC name is N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide |
| PubChem CID | 103774902 |
| Molecular Formula | C7H12N2O3S2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H12N2O3S2/c1-2-3-14(11,12)8-4-6-5-13-7(10)9-6/h5,8H,2-4H2,1H3,(H,9,10) |
| InChIKey | BONLTWYQDAAROF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The IUPAC name of N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide (CID 103774902) is N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide.
What is the SMILES notation for N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The canonical SMILES for N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide is CCCS(=O)(=O)NCc1csc(=O)[nH]1.
What is the InChIKey of N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
The InChIKey is BONLTWYQDAAROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S2/c1-2-3-14(11,12)8-4-6-5-13-7(10)9-6/h5,8H,2-4H2,1H3,(H,9,10).
What are the key properties of N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide?
N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide has a molecular weight of 236.32 g/mol, XLogP of 0.27, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]propane-1-sulfonamide is sourced from PubChem (CID 103774902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).