C14H20O2S — CID 10377540
9,9,12-trimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide (PubChem CID 10377540) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 9,9,12-trimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide.
| Compound Name | 9,9,12-trimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide |
|---|---|
| PubChem CID | 10377540 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 9,9,12-trimethyl-2λ6-thiatricyclo[6.3.1.04,12]dodeca-3,7-diene 2,2-dioxide |
| SMILES | CC1(C)CCC2C3(C)C(=CS2(=O)=O)CCC=C13 |
| InChI | InChI=1S/C14H20O2S/c1-13(2)8-7-12-14(3)10(9-17(12,15)16)5-4-6-11(13)14/h6,9,12H,4-5,7-8H2,1-3H3 |
| InChIKey | DMSWTXUPIVVSGO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|