C17H31N3 — CID 103776522
3-cyclopentyl-N-[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]propan-1-amine (PubChem CID 103776522) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 3-cyclopentyl-N-[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]propan-1-amine.
| Compound Name | 3-cyclopentyl-N-[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103776522 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 3-cyclopentyl-N-[1-(1-ethyl-3,5-dimethylpyrazol-4-yl)ethyl]propan-1-amine |
| SMILES | CCn1nc(C)c(C(C)NCCCC2CCCC2)c1C |
| InChI | InChI=1S/C17H31N3/c1-5-20-15(4)17(14(3)19-20)13(2)18-12-8-11-16-9-6-7-10-16/h13,16,18H,5-12H2,1-4H3 |
| InChIKey | VSUGDUXUEREHET-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|