C12H20N2O2S3 — CID 103776579
N-[3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propyl]methanesulfonamide (PubChem CID 103776579) has the molecular formula C12H20N2O2S3 and a molecular weight of 320.51 g/mol. Its IUPAC name is N-[3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 103776579 |
| Molecular Formula | C12H20N2O2S3 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[3-[[(6S)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]amino]propyl]methanesulfonamide |
| SMILES | C[C@H]1CC(NCCCNS(C)(=O)=O)c2ccsc2S1 |
| InChI | InChI=1S/C12H20N2O2S3/c1-9-8-11(10-4-7-17-12(10)18-9)13-5-3-6-14-19(2,15)16/h4,7,9,11,13-14H,3,5-6,8H2,1-2H3/t9-,11?/m0/s1 |
| InChIKey | OLKVFJXQUIEBJV-FTNKSUMCSA-N |
| XLogP | 2.20 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|