About 1-anilinopropan-2-yl benzoate
1-anilinopropan-2-yl benzoate (PubChem CID 10377664) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-anilinopropan-2-yl benzoate.
Molecular Properties
| Compound Name | 1-anilinopropan-2-yl benzoate |
| PubChem CID | 10377664 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-anilinopropan-2-yl benzoate |
| SMILES | CC(CNc1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2-11,13,17H,12H2,1H3 |
| InChIKey | QGJMJUNTCKBWCJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-anilinopropan-2-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilinopropan-2-yl benzoate?
The IUPAC name of 1-anilinopropan-2-yl benzoate (CID 10377664) is 1-anilinopropan-2-yl benzoate.
What is the SMILES notation for 1-anilinopropan-2-yl benzoate?
The canonical SMILES for 1-anilinopropan-2-yl benzoate is CC(CNc1ccccc1)OC(=O)c1ccccc1.
What is the InChIKey of 1-anilinopropan-2-yl benzoate?
The InChIKey is QGJMJUNTCKBWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14/h2-11,13,17H,12H2,1H3.
What are the key properties of 1-anilinopropan-2-yl benzoate?
1-anilinopropan-2-yl benzoate has a molecular weight of 255.32 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilinopropan-2-yl benzoate is sourced from PubChem (CID 10377664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).