C21H14BrClN4O2S — CID 1037767
N-(4-bromophenyl)-2-[[(3R,4S)-4-(2-chlorophenyl)-3,5-dicyano-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetamide (PubChem CID 1037767) has the molecular formula C21H14BrClN4O2S and a molecular weight of 501.79 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[[(3R,4S)-4-(2-chlorophenyl)-3,5-dicyano-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[[(3R,4S)-4-(2-chlorophenyl)-3,5-dicyano-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 1037767 |
| Molecular Formula | C21H14BrClN4O2S |
| Molecular Weight | 501.79 g/mol |
| Exact Mass | 499.97 |
| IUPAC Name | N-(4-bromophenyl)-2-[[(3R,4S)-4-(2-chlorophenyl)-3,5-dicyano-2-oxo-3,4-dihydro-1H-pyridin-6-yl]sulfanyl]acetamide |
| SMILES | N#CC1=C(SCC(=O)Nc2ccc(Br)cc2)NC(=O)[C@@H](C#N)[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C21H14BrClN4O2S/c22-12-5-7-13(8-6-12)26-18(28)11-30-21-16(10-25)19(15(9-24)20(29)27-21)14-3-1-2-4-17(14)23/h1-8,15,19H,11H2,(H,26,28)(H,27,29)/t15-,19-/m0/s1 |
| InChIKey | URRVUQKJEPGFSK-KXBFYZLASA-N |
| XLogP | 4.56 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_E(4)', 'substructure': 'N/A'} |
|---|