About methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate
methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate (PubChem CID 10377702) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate |
| PubChem CID | 10377702 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate |
| SMILES | COC(=O)CC1C(=O)N(C(C)C)C(=O)N1C(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-7(2)13-9(6-10(15)18-5)11(16)14(8(3)4)12(13)17/h7-9H,6H2,1-5H3 |
| InChIKey | WWZRHKHECAXBNN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate?
The IUPAC name of methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate (CID 10377702) is methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate.
What is the SMILES notation for methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate?
The canonical SMILES for methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate is COC(=O)CC1C(=O)N(C(C)C)C(=O)N1C(C)C.
What is the InChIKey of methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate?
The InChIKey is WWZRHKHECAXBNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c1-7(2)13-9(6-10(15)18-5)11(16)14(8(3)4)12(13)17/h7-9H,6H2,1-5H3.
What are the key properties of methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate?
methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate has a molecular weight of 256.30 g/mol, XLogP of 1.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2,5-dioxo-1,3-di(propan-2-yl)imidazolidin-4-yl]acetate is sourced from PubChem (CID 10377702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).