C14H16N4O — CID 10377709
N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indazole-5-carboxamide (PubChem CID 10377709) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indazole-5-carboxamide.
| Compound Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 10377709 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-[(1S,2R,4R)-7-azabicyclo[2.2.1]heptan-2-yl]-1H-indazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1C[C@H]2CC[C@@H]1N2)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C14H16N4O/c19-14(17-13-6-10-2-4-12(13)16-10)8-1-3-11-9(5-8)7-15-18-11/h1,3,5,7,10,12-13,16H,2,4,6H2,(H,15,18)(H,17,19)/t10-,12+,13-/m1/s1 |
| InChIKey | WBHDTVSQZXJOFU-KGYLQXTDSA-N |
| XLogP | 1.19 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |