C12H7N3O2S — CID 10377751
(5E)-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 10377751) has the molecular formula C12H7N3O2S and a molecular weight of 257.27 g/mol. Its IUPAC name is (5E)-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10377751 |
| Molecular Formula | C12H7N3O2S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | (5E)-5-(quinoxalin-6-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc3nccnc3c2)S1 |
| InChI | InChI=1S/C12H7N3O2S/c16-11-10(18-12(17)15-11)6-7-1-2-8-9(5-7)14-4-3-13-8/h1-6H,(H,15,16,17)/b10-6+ |
| InChIKey | SQWZFLMPDUSYGV-UXBLZVDNSA-N |
| XLogP | 1.95 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|