C16H32N2O3S — CID 103778442
tert-butyl 4-[(3-methylsulfinylbutylamino)methyl]piperidine-1-carboxylate (PubChem CID 103778442) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is tert-butyl 4-[(3-methylsulfinylbutylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-methylsulfinylbutylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103778442 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | tert-butyl 4-[(3-methylsulfinylbutylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(CCNCC1CCN(C(=O)OC(C)(C)C)CC1)S(C)=O |
| InChI | InChI=1S/C16H32N2O3S/c1-13(22(5)20)6-9-17-12-14-7-10-18(11-8-14)15(19)21-16(2,3)4/h13-14,17H,6-12H2,1-5H3 |
| InChIKey | BFZJNZWOMFXSPV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|