C15H23BrN2O2S — CID 103779237
N-[1-(4-bromophenyl)propan-2-yl]-1-methylsulfonylpiperidin-4-amine (PubChem CID 103779237) has the molecular formula C15H23BrN2O2S and a molecular weight of 375.33 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)propan-2-yl]-1-methylsulfonylpiperidin-4-amine.
| Compound Name | N-[1-(4-bromophenyl)propan-2-yl]-1-methylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 103779237 |
| Molecular Formula | C15H23BrN2O2S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-[1-(4-bromophenyl)propan-2-yl]-1-methylsulfonylpiperidin-4-amine |
| SMILES | CC(Cc1ccc(Br)cc1)NC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H23BrN2O2S/c1-12(11-13-3-5-14(16)6-4-13)17-15-7-9-18(10-8-15)21(2,19)20/h3-6,12,15,17H,7-11H2,1-2H3 |
| InChIKey | ANIZHIRHWQKOEO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |