C15H8N2OS — CID 10378116
pyrido[3,2-a]phenothiazin-5-one (PubChem CID 10378116) has the molecular formula C15H8N2OS and a molecular weight of 264.31 g/mol. Its IUPAC name is pyrido[3,2-a]phenothiazin-5-one.
| Compound Name | pyrido[3,2-a]phenothiazin-5-one |
|---|---|
| PubChem CID | 10378116 |
| Molecular Formula | C15H8N2OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | pyrido[3,2-a]phenothiazin-5-one |
| SMILES | O=c1cc2sc3ccccc3nc-2c2cccnc12 |
| InChI | InChI=1S/C15H8N2OS/c18-11-8-13-15(9-4-3-7-16-14(9)11)17-10-5-1-2-6-12(10)19-13/h1-8H |
| InChIKey | XVULXICEZDPLLK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|