About benzyl 2-bromo-2,2-difluoroacetate
benzyl 2-bromo-2,2-difluoroacetate (PubChem CID 10378165) has the molecular formula C9H7BrF2O2
and a molecular weight of 265.05 g/mol. Its IUPAC name is benzyl 2-bromo-2,2-difluoroacetate.
Molecular Properties
| Compound Name | benzyl 2-bromo-2,2-difluoroacetate |
| PubChem CID | 10378165 |
| Molecular Formula | C9H7BrF2O2 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | benzyl 2-bromo-2,2-difluoroacetate |
| SMILES | O=C(OCc1ccccc1)C(F)(F)Br |
| InChI | InChI=1S/C9H7BrF2O2/c10-9(11,12)8(13)14-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | ZYBCQKXKMSMAAO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-bromo-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-bromo-2,2-difluoroacetate?
The IUPAC name of benzyl 2-bromo-2,2-difluoroacetate (CID 10378165) is benzyl 2-bromo-2,2-difluoroacetate.
What is the SMILES notation for benzyl 2-bromo-2,2-difluoroacetate?
The canonical SMILES for benzyl 2-bromo-2,2-difluoroacetate is O=C(OCc1ccccc1)C(F)(F)Br.
What is the InChIKey of benzyl 2-bromo-2,2-difluoroacetate?
The InChIKey is ZYBCQKXKMSMAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF2O2/c10-9(11,12)8(13)14-6-7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of benzyl 2-bromo-2,2-difluoroacetate?
benzyl 2-bromo-2,2-difluoroacetate has a molecular weight of 265.05 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-bromo-2,2-difluoroacetate is sourced from PubChem (CID 10378165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).