About 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol
3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 103781968) has the molecular formula C16H25NO2S
and a molecular weight of 295.45 g/mol. Its IUPAC name is 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol |
| PubChem CID | 103781968 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | CC1(C)CC(NCCSCCCO)c2ccccc2O1 |
| InChI | InChI=1S/C16H25NO2S/c1-16(2)12-14(17-8-11-20-10-5-9-18)13-6-3-4-7-15(13)19-16/h3-4,6-7,14,17-18H,5,8-12H2,1-2H3 |
| InChIKey | QGZXALYTMFUBLK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol?
The IUPAC name of 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol (CID 103781968) is 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol.
What is the SMILES notation for 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol?
The canonical SMILES for 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol is CC1(C)CC(NCCSCCCO)c2ccccc2O1.
What is the InChIKey of 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol?
The InChIKey is QGZXALYTMFUBLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2S/c1-16(2)12-14(17-8-11-20-10-5-9-18)13-6-3-4-7-15(13)19-16/h3-4,6-7,14,17-18H,5,8-12H2,1-2H3.
What are the key properties of 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol?
3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol has a molecular weight of 295.45 g/mol, XLogP of 2.99, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]ethylsulfanyl]propan-1-ol is sourced from PubChem (CID 103781968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).