C16H26O3 — CID 10378258
(E,2S)-2-[(2S,5R)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-hydroxy-6-methylhept-4-en-3-one (PubChem CID 10378258) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (E,2S)-2-[(2S,5R)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-hydroxy-6-methylhept-4-en-3-one.
| Compound Name | (E,2S)-2-[(2S,5R)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-hydroxy-6-methylhept-4-en-3-one |
|---|---|
| PubChem CID | 10378258 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (E,2S)-2-[(2S,5R)-5-ethenyl-2,5-dimethyloxolan-2-yl]-6-hydroxy-6-methylhept-4-en-3-one |
| SMILES | C=C[C@@]1(C)CC[C@@](C)([C@H](C)C(=O)/C=C/C(C)(C)O)O1 |
| InChI | InChI=1S/C16H26O3/c1-7-15(5)10-11-16(6,19-15)12(2)13(17)8-9-14(3,4)18/h7-9,12,18H,1,10-11H2,2-6H3/b9-8+/t12-,15+,16+/m1/s1 |
| InChIKey | IYHIOPKYJASMTA-FCCIAFAISA-N |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|