C16H30N2O3 — CID 103783530
tert-butyl 3-[1-(oxan-4-yl)ethylamino]pyrrolidine-1-carboxylate (PubChem CID 103783530) has the molecular formula C16H30N2O3 and a molecular weight of 298.43 g/mol. Its IUPAC name is tert-butyl 3-[1-(oxan-4-yl)ethylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(oxan-4-yl)ethylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103783530 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | tert-butyl 3-[1-(oxan-4-yl)ethylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(NC1CCN(C(=O)OC(C)(C)C)C1)C1CCOCC1 |
| InChI | InChI=1S/C16H30N2O3/c1-12(13-6-9-20-10-7-13)17-14-5-8-18(11-14)15(19)21-16(2,3)4/h12-14,17H,5-11H2,1-4H3 |
| InChIKey | AIPAGMUAUDQHOI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |