C14H24O3Si — CID 10378358
[(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-dimethyl-propan-2-yloxysilane (PubChem CID 10378358) has the molecular formula C14H24O3Si and a molecular weight of 268.43 g/mol. Its IUPAC name is [(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-dimethyl-propan-2-yloxysilane.
| Compound Name | [(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-dimethyl-propan-2-yloxysilane |
|---|---|
| PubChem CID | 10378358 |
| Molecular Formula | C14H24O3Si |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [(3aS,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-dimethyl-propan-2-yloxysilane |
| SMILES | CC(C)O[Si](C)(C)C1=CC=C[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H24O3Si/c1-10(2)17-18(5,6)12-9-7-8-11-13(12)16-14(3,4)15-11/h7-11,13H,1-6H3/t11-,13-/m0/s1 |
| InChIKey | KIMQDBXCAAUBMD-AAEUAGOBSA-N |
| XLogP | 3.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|